Introduction：Basic information about CAS 146824-84-2|4(1H)-Pyridazinone, 6-methyl-3-(2-quinolinylmethoxy)-1-(3-(trifluorome thyl)phenyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4(1H)-Pyridazinone, 6-methyl-3-(2-quinolinylmethoxy)-1-(3-(trifluorome thyl)phenyl)- |
|---|
| CAS Number | 146824-84-2 | Molecular Weight | 411.37700 |
|---|
| Density | 1.32g/cm3 | Boiling Point | 518.3ºC at 760mmHg |
|---|
| Molecular Formula | C22H16F3N3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 267.3ºC |
|---|
Names
| Name | 6-methyl-3-(quinolin-2-ylmethoxy)-1-[3-(trifluoromethyl)phenyl]pyridazin-4-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.32g/cm3 |
|---|
| Boiling Point | 518.3ºC at 760mmHg |
|---|
| Molecular Formula | C22H16F3N3O2 |
|---|
| Molecular Weight | 411.37700 |
|---|
| Flash Point | 267.3ºC |
|---|
| Exact Mass | 411.11900 |
|---|
| PSA | 57.01000 |
|---|
| LogP | 4.68690 |
|---|
| Vapour Pressure | 7.59E-11mmHg at 25°C |
|---|
| Index of Refraction | 1.6 |
|---|
| InChIKey | MEDBYYVLGPWKFQ-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(=O)c(OCc2ccc3ccccc3n2)nn1-c1cccc(C(F)(F)F)c1 |
|---|
Synonyms
| 6-Methyl-3-(2-quinolinylmethoxy)-1-(3-(trifluoromethyl)phenyl)-4(1H)-pyridazinone |
| m-Trifluoromethyl phenyl-1 dihydro-1,4 oxo-4 (quinolyl-2 methoxy)-3 methyl-6 pyridazine |
| 4(1H)-Pyridazinone,6-methyl-3-(2-quinolinylmethoxy)-1-(3-(trifluoromethyl)phenyl) |
