Introduction：Basic information about CAS 146824-79-5|4(1H)-Pyridazinone, 6-methyl-3-(phenylmethoxy)-1-(3-(trifluoromethyl)p henyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4(1H)-Pyridazinone, 6-methyl-3-(phenylmethoxy)-1-(3-(trifluoromethyl)p henyl)- |
|---|
| CAS Number | 146824-79-5 | Molecular Weight | 360.33000 |
|---|
| Density | 1.26g/cm3 | Boiling Point | 444.7ºC at 760 mmHg |
|---|
| Molecular Formula | C19H15F3N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 222.7ºC |
|---|
Names
| Name | 6-methyl-3-phenylmethoxy-1-[3-(trifluoromethyl)phenyl]pyridazin-4-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.26g/cm3 |
|---|
| Boiling Point | 444.7ºC at 760 mmHg |
|---|
| Molecular Formula | C19H15F3N2O2 |
|---|
| Molecular Weight | 360.33000 |
|---|
| Flash Point | 222.7ºC |
|---|
| Exact Mass | 360.10900 |
|---|
| PSA | 44.12000 |
|---|
| LogP | 4.13870 |
|---|
| Vapour Pressure | 4.2E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.555 |
|---|
| InChIKey | YCWMDSBHBGWSKQ-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(=O)c(OCc2ccccc2)nn1-c1cccc(C(F)(F)F)c1 |
|---|
Synonyms
| 4(1H)-Pyridazinone,6-methyl-3-(phenylmethoxy)-1-(3-(trifluoromethyl)phenyl) |
| 6-Methyl-3-(phenylmethoxy)-1-(3-(trifluoromethyl)phenyl)-4(1H)-pyridazinone |
