Introduction：Basic information about CAS 150215-07-9|5-[(Ethoxycarbonyl)amino]-1,2,4-thiadiazole-3-acetic acid methyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-[(Ethoxycarbonyl)amino]-1,2,4-thiadiazole-3-acetic acid methyl ester |
|---|
| CAS Number | 150215-07-9 | Molecular Weight | 245.25600 |
|---|
| Density | 1.408g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C8H11N3O4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | methyl 2-[5-(ethoxycarbonylamino)-1,2,4-thiadiazol-3-yl]acetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.408g/cm3 |
|---|
| Molecular Formula | C8H11N3O4S |
|---|
| Molecular Weight | 245.25600 |
|---|
| Exact Mass | 245.04700 |
|---|
| PSA | 118.65000 |
|---|
| LogP | 0.89500 |
|---|
| Index of Refraction | 1.574 |
|---|
| InChIKey | WRUIUWMHBQJODA-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)Nc1nc(CC(=O)OC)ns1 |
|---|
Synonyms
| methyl 2-(5-ethoxycarbonylamino-1,2,4-thiadiazol-3-yl)acetate |
