Introduction：Basic information about CAS 57666-58-7|5-(2-NITROPHENYL)-2-FURONITRILE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-(2-NITROPHENYL)-2-FURONITRILE |
|---|
| CAS Number | 57666-58-7 | Molecular Weight | 214.17700 |
|---|
| Density | 1.38g/cm3 | Boiling Point | 362.4ºC at 760 mmHg |
|---|
| Molecular Formula | C11H6N2O3 | Melting Point | 95-99ºC(lit.) |
|---|
| MSDS | USA | Flash Point | 173ºC |
|---|
| Symbol |
GHS05, GHS06 | Signal Word | Danger |
|---|
Names
| Name | 5-(2-nitrophenyl)furan-2-carbonitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.38g/cm3 |
|---|
| Boiling Point | 362.4ºC at 760 mmHg |
|---|
| Melting Point | 95-99ºC(lit.) |
|---|
| Molecular Formula | C11H6N2O3 |
|---|
| Molecular Weight | 214.17700 |
|---|
| Flash Point | 173ºC |
|---|
| Exact Mass | 214.03800 |
|---|
| PSA | 82.75000 |
|---|
| LogP | 3.24968 |
|---|
| Index of Refraction | 1.624 |
|---|
| InChIKey | CMKOTLZKPXMTBM-UHFFFAOYSA-N |
|---|
| SMILES | N#Cc1ccc(-c2ccccc2[N+](=O)[O-])o1 |
|---|
Safety Information
| Symbol |
GHS05, GHS06 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H301-H315-H318-H335 |
|---|
| Precautionary Statements | P261-P280-P301 + P310-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
|---|
| Risk Phrases | 25-37/38-41 |
|---|
| Safety Phrases | 26-39-45 |
|---|
| RIDADR | UN 2811 6.1/PG 3 |
|---|
Synonyms
| 5-(2-nitro-phenyl)-furan-2-carbonitrile |
| 5-(2-Nitrophenyl)-2-furonitrile |
| 5-(2-Nitrophenyl)-2-furonitril |
| MFCD02127674 |
