Introduction:Basic information about CAS 307496-37-3|2,4-diamino-6-mercapto-pyrimidine sulfate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,4-diamino-6-mercapto-pyrimidine sulfate |
|---|
| CAS Number | 307496-37-3 | Molecular Weight | 240.26100 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C4H8N4O4S2 | Melting Point | >300ºC (dec.)(lit.) |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2,6-diamino-1H-pyrimidine-4-thione,sulfuric acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | >300ºC (dec.)(lit.) |
|---|
| Molecular Formula | C4H8N4O4S2 |
|---|
| Molecular Weight | 240.26100 |
|---|
| Exact Mass | 239.99900 |
|---|
| PSA | 199.60000 |
|---|
| LogP | 1.52010 |
|---|
| InChIKey | FVSVUQJNAZQSFX-UHFFFAOYSA-N |
|---|
| SMILES | Nc1cc(=S)nc(N)[nH]1.O=S(=O)(O)O |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2933599090 |
|---|
Customs
| HS Code | 2933599090 |
|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 2,4-Diamino-6-mercapto-pyrimidine sulfate |
| 2,6-Diamino-4-pyrimidinethiol sulfate |
| 2,4-Diamino-6-mercaptopyrimidine sulfate salt |
| M-1719 |
| MFCD01863745 |