Introduction：Basic information about CAS 158178-36-0|3,4-difluoro-5-nitrophenylboronic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,4-difluoro-5-nitrophenylboronic acid |
|---|
| CAS Number | 158178-36-0 | Molecular Weight | 202.90800 |
|---|
| Density | 1.57g/cm3 | Boiling Point | 373.5ºC at 760mmHg |
|---|
| Molecular Formula | C6H4BF2NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 179.7ºC |
|---|
Names
| Name | 3,4-difluoro-5-nitrophenylboronic acid |
|---|
Chemical & Physical Properties
| Density | 1.57g/cm3 |
|---|
| Boiling Point | 373.5ºC at 760mmHg |
|---|
| Molecular Formula | C6H4BF2NO4 |
|---|
| Molecular Weight | 202.90800 |
|---|
| Flash Point | 179.7ºC |
|---|
| Exact Mass | 203.02000 |
|---|
| PSA | 86.28000 |
|---|
| LogP | 0.07600 |
|---|
| Vapour Pressure | 3.06E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.526 |
|---|
| InChIKey | PZEDUBGEXJWKJW-UHFFFAOYSA-N |
|---|
| SMILES | OB(O)c1ccc(OC(F)(F)F)c(F)c1F |
|---|
