Introduction:Basic information about CAS 14097-35-9|2-Methyl-7-nitro-1,2,3,4-tetrahydroisoquinoline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Methyl-7-nitro-1,2,3,4-tetrahydroisoquinoline |
|---|
| CAS Number | 14097-35-9 | Molecular Weight | 192.21400 |
|---|
| Density | 1.208g/cm3 | Boiling Point | 296.931ºC at 760 mmHg |
|---|
| Molecular Formula | C10H12N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 133.379ºC |
|---|
Names
| Name | 2-Methyl-7-nitro-1,2,3,4-tetrahydroisoquinoline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.208g/cm3 |
|---|
| Boiling Point | 296.931ºC at 760 mmHg |
|---|
| Molecular Formula | C10H12N2O2 |
|---|
| Molecular Weight | 192.21400 |
|---|
| Flash Point | 133.379ºC |
|---|
| Exact Mass | 192.09000 |
|---|
| PSA | 49.06000 |
|---|
| LogP | 2.04380 |
|---|
| Vapour Pressure | 0.001mmHg at 25°C |
|---|
| Index of Refraction | 1.584 |
|---|
| InChIKey | PUMCPMLEPPOZRX-UHFFFAOYSA-N |
|---|
| SMILES | CN1CCc2ccc([N+](=O)[O-])cc2C1 |
|---|
Synonyms
| 2-methyl-7-nitro-1,2,3,4-tetrahydro-isoquinoline |
| 7-nitro-2-methyl-1,2,3,4-tetrahydroisoquinoline |
| 2-Methyl-7-methylthiooxazolo<5,4-d>pyrimidin |
| 2-Methyl-7-nitro-1,2,3,4-tetrahydro-isochinolin |