Introduction:Basic information about CAS 216059-76-6|7-(4-methylpiperazin-1-yl)-1,2,3,4-tetrahydroquinoline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 7-(4-methylpiperazin-1-yl)-1,2,3,4-tetrahydroquinoline |
|---|
| CAS Number | 216059-76-6 | Molecular Weight | 231.33700 |
|---|
| Density | 1.073g/cm3 | Boiling Point | 401.826ºC at 760 mmHg |
|---|
| Molecular Formula | C14H21N3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 226.48ºC |
|---|
Names
| Name | 7-(4-methylpiperazin-1-yl)-1,2,3,4-tetrahydroquinoline |
|---|
Chemical & Physical Properties
| Density | 1.073g/cm3 |
|---|
| Boiling Point | 401.826ºC at 760 mmHg |
|---|
| Molecular Formula | C14H21N3 |
|---|
| Molecular Weight | 231.33700 |
|---|
| Flash Point | 226.48ºC |
|---|
| Exact Mass | 231.17400 |
|---|
| PSA | 18.51000 |
|---|
| LogP | 1.93740 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.565 |
|---|
| InChIKey | XRXCUHSBQWJPQY-UHFFFAOYSA-N |
|---|
| SMILES | CN1CCN(c2ccc3c(c2)NCCC3)CC1 |
|---|