Introduction：Basic information about CAS 112190-03-1|4-Chloro-6-ethoxyquinoline-3-carboxylic acid ethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Chloro-6-ethoxyquinoline-3-carboxylic acid ethyl ester |
|---|
| CAS Number | 112190-03-1 | Molecular Weight | 279.71900 |
|---|
| Density | 1.25g/cm3 | Boiling Point | 380.2ºC at 760 mmHg |
|---|
| Molecular Formula | C14H14ClNO3 | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 183.8ºC |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | ethyl 4-chloro-6-ethoxyquinoline-3-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.25g/cm3 |
|---|
| Boiling Point | 380.2ºC at 760 mmHg |
|---|
| Molecular Formula | C14H14ClNO3 |
|---|
| Molecular Weight | 279.71900 |
|---|
| Flash Point | 183.8ºC |
|---|
| Exact Mass | 279.06600 |
|---|
| PSA | 48.42000 |
|---|
| LogP | 3.46360 |
|---|
| Vapour Pressure | 5.53E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.583 |
|---|
| InChIKey | SSOGSEBLCQKKNR-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1cnc2ccc(OCC)cc2c1Cl |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H319 |
|---|
| Precautionary Statements | P305 + P351 + P338 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| 4-Chloro-6-ethoxyquinoline-3-carboxylic acid ethyl ester |
| 6-ethoxy-4-chloro-quinoline-3-carboxylic acid ethyl ester |
| 6-Aethoxy-4-chlor-chinolin-3-carbonsaeure-aethylester |
