Introduction：Basic information about CAS 126518-76-1|asarumin B, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | asarumin B |
|---|
| CAS Number | 126518-76-1 | Molecular Weight | 236.26400 |
|---|
| Density | 1.103g/cm3 | Boiling Point | 334.7ºC at 760mmHg |
|---|
| Molecular Formula | C13H16O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 162.9ºC |
|---|
Names
| Name | [(2R)-1-methoxy-3-methyl-1-oxobutan-2-yl] benzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.103g/cm3 |
|---|
| Boiling Point | 334.7ºC at 760mmHg |
|---|
| Molecular Formula | C13H16O4 |
|---|
| Molecular Weight | 236.26400 |
|---|
| Flash Point | 162.9ºC |
|---|
| Exact Mass | 236.10500 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 2.04100 |
|---|
| Vapour Pressure | 0.000126mmHg at 25°C |
|---|
| Index of Refraction | 1.499 |
|---|
| InChIKey | AJCKKMJVWKRHNA-LLVKDONJSA-N |
|---|
| SMILES | COC(=O)C(OC(=O)c1ccccc1)C(C)C |
|---|
Synonyms
| Methyl 2-benzoyloxyisopentanoate |
| Asarumin B |
