Introduction：Basic information about CAS 144017-84-5|trans-(4-Amino-1-benzylpyrrolidin-3-yl)-acetic acid ethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | trans-(4-Amino-1-benzylpyrrolidin-3-yl)-acetic acid ethyl ester |
|---|
| CAS Number | 144017-84-5 | Molecular Weight | 262.34700 |
|---|
| Density | 1.094g/cm3 | Boiling Point | 354.5ºC at 760mmHg |
|---|
| Molecular Formula | C15H22N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 168.2ºC |
|---|
Names
| Name | ethyl 2-(4-amino-1-benzylpyrrolidin-3-yl)acetate |
|---|
Chemical & Physical Properties
| Density | 1.094g/cm3 |
|---|
| Boiling Point | 354.5ºC at 760mmHg |
|---|
| Molecular Formula | C15H22N2O2 |
|---|
| Molecular Weight | 262.34700 |
|---|
| Flash Point | 168.2ºC |
|---|
| Exact Mass | 262.16800 |
|---|
| PSA | 55.56000 |
|---|
| LogP | 2.03710 |
|---|
| Vapour Pressure | 3.33E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.539 |
|---|
| InChIKey | NZWSMTBLVXYYPK-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)CC1CN(Cc2ccccc2)CC1N |
|---|
