Introduction：Basic information about CAS 147290-67-3|tert-butyl 3-methyl-4-nitrobenzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tert-butyl 3-methyl-4-nitrobenzoate |
|---|
| CAS Number | 147290-67-3 | Molecular Weight | 237.25200 |
|---|
| Density | 1.157g/cm3 | Boiling Point | 345.31ºC at 760 mmHg |
|---|
| Molecular Formula | C12H15NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 142.751ºC |
|---|
Names
| Name | tert-butyl 3-methyl-4-nitrobenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.157g/cm3 |
|---|
| Boiling Point | 345.31ºC at 760 mmHg |
|---|
| Molecular Formula | C12H15NO4 |
|---|
| Molecular Weight | 237.25200 |
|---|
| Flash Point | 142.751ºC |
|---|
| Exact Mass | 237.10000 |
|---|
| PSA | 72.12000 |
|---|
| LogP | 3.38170 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.529 |
|---|
| InChIKey | SWAVZCKLGYSSQN-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(C(=O)OC(C)(C)C)ccc1[N+](=O)[O-] |
|---|
Synonyms
| tert-butyl 3-methyl-4-nitro benzoate |
| 3-methyl-4-nitrobenzoic acid tert-butyl ester |
| 4-amino-3-methyl-1-tert-butyl benzoate |
| t-butyl 3-methyl-4-nitro-benzoate |
| Benzoic acid,3-methyl-4-nitro-,1,1-dimethylethyl ester |
