Introduction:Basic information about CAS 426823-25-8|3-[4-(trifluoromethyl)phenyl]pyridine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-[4-(trifluoromethyl)phenyl]pyridine |
|---|
| CAS Number | 426823-25-8 | Molecular Weight | 223.19400 |
|---|
| Density | 1.23g/cm3 | Boiling Point | 274.753ºC at 760 mmHg |
|---|
| Molecular Formula | C12H8F3N | Melting Point | / |
|---|
| MSDS | / | Flash Point | 119.966ºC |
|---|
Names
| Name | 3-[4-(trifluoromethyl)phenyl]pyridine |
|---|
Chemical & Physical Properties
| Density | 1.23g/cm3 |
|---|
| Boiling Point | 274.753ºC at 760 mmHg |
|---|
| Molecular Formula | C12H8F3N |
|---|
| Molecular Weight | 223.19400 |
|---|
| Flash Point | 119.966ºC |
|---|
| Exact Mass | 223.06100 |
|---|
| PSA | 12.89000 |
|---|
| LogP | 3.76740 |
|---|
| Index of Refraction | 1.506 |
|---|
| InChIKey | NLEVCXWLTHEKMV-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(F)c1ccc(-c2cccnc2)cc1 |
|---|