Introduction：Basic information about CAS 20633-93-6|Fortunellin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Fortunellin |
|---|
| CAS Number | 20633-93-6 | Molecular Weight | 592.54500 |
|---|
| Density | 1.62g/cm3 | Boiling Point | 888.7ºC at 760 mmHg |
|---|
| Molecular Formula | C28H32O14 | Melting Point | 193-198ºC |
|---|
| MSDS | / | Flash Point | 293.4ºC |
|---|
Names
| Name | 5-hydroxy-2-(4-methoxyphenyl)-7-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]oxan-2-yl]oxychromen-4-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.62g/cm3 |
|---|
| Boiling Point | 888.7ºC at 760 mmHg |
|---|
| Melting Point | 193-198ºC |
|---|
| Molecular Formula | C28H32O14 |
|---|
| Molecular Weight | 592.54500 |
|---|
| Flash Point | 293.4ºC |
|---|
| Exact Mass | 592.17900 |
|---|
| PSA | 217.97000 |
|---|
| Vapour Pressure | 6.89E-34mmHg at 25°C |
|---|
| Index of Refraction | 1.693 |
|---|
| InChIKey | MLWDGPFGTFOLRJ-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(-c2cc(=O)c3c(O)cc(OC4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O)cc3o2)cc1 |
|---|
Synonyms
| Acacetin-7-O-neohesperidoside |
| GNF-Pf-2160 |
| Fortunellin |
