Introduction：Basic information about CAS 43157-50-2|2-THIOADENOSINE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-THIOADENOSINE |
|---|
| CAS Number | 43157-50-2 | Molecular Weight | 299.30600 |
|---|
| Density | 2.18g/cm3 | Boiling Point | 544.5ºC at 760 mmHg |
|---|
| Molecular Formula | C10H13N5O4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 283.1ºC |
|---|
Names
| Name | 6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purine-2-thione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.18g/cm3 |
|---|
| Boiling Point | 544.5ºC at 760 mmHg |
|---|
| Molecular Formula | C10H13N5O4S |
|---|
| Molecular Weight | 299.30600 |
|---|
| Flash Point | 283.1ºC |
|---|
| Exact Mass | 299.06900 |
|---|
| PSA | 174.53000 |
|---|
| Index of Refraction | 1.975 |
|---|
| InChIKey | LTESOZAUMTUKQX-UUOKFMHZSA-N |
|---|
| SMILES | Nc1[nH]c(=S)nc2c1ncn2C1OC(CO)C(O)C1O |
|---|
Synonyms
| 2-thio-isoguanosine |
| adenosine-2-thione |
| Adenosine,1,2-dihydro-2-thioxo |
| 2-Thioadenosine |
| 2-thioladenosine |
| 2-Mercaptoadenosine |
