Introduction：Basic information about CAS 68140-48-7|Traesolide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Traesolide |
|---|
| CAS Number | 68140-48-7 | Molecular Weight | 258.39800 |
|---|
| Density | 0.933 g/cm3 | Boiling Point | 350ºC at 760 mmHg |
|---|
| Molecular Formula | C18H26O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 146.3ºC |
|---|
Names
| Name | traseolide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.933 g/cm3 |
|---|
| Boiling Point | 350ºC at 760 mmHg |
|---|
| Molecular Formula | C18H26O |
|---|
| Molecular Weight | 258.39800 |
|---|
| Flash Point | 146.3ºC |
|---|
| Exact Mass | 258.19800 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 4.86450 |
|---|
| Index of Refraction | 1.498 |
|---|
| InChIKey | IMRYETFJNLKUHK-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)c1cc2c(cc1C)C(C)(C)C(C)C2C(C)C |
|---|
Synonyms
| Traesolide |
| ATII |
| Einecs 268-799-0 |
| ATH |
| 1,1,2,6-Tetramethyl-3-isopropyl-5-acetylindan |
| TRASEOLIDE |
| 5-Acetyl-1,1,2,6-tetramethyl-3-isopropylindane |
| 6-acetyl 1-isopropyl 2,3,3,5-tetramethyl indane |
| 5-Acetyl-1,1,2,6-tetraMethyl-3-isopropylindan |
