Introduction：Basic information about CAS 57301-22-1|3-hydroxy-4-[[2-methoxy-5-[(phenylmethyl)sulfonyl]phenyl]azo]-N-phenyl-2-Naphthalenec, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-hydroxy-4-[[2-methoxy-5-[(phenylmethyl)sulfonyl]phenyl]azo]-N-phenyl-2-Naphthalenecarboxamide |
|---|
| CAS Number | 57301-22-1 | Molecular Weight | 551.61200 |
|---|
| Density | 1.3g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C31H25N3O5S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (4Z)-4-[(5-benzylsulfonyl-2-methoxyphenyl)hydrazinylidene]-3-oxo-N-phenylnaphthalene-2-carboxamide |
|---|
Chemical & Physical Properties
| Density | 1.3g/cm3 |
|---|
| Molecular Formula | C31H25N3O5S |
|---|
| Molecular Weight | 551.61200 |
|---|
| Exact Mass | 551.15100 |
|---|
| PSA | 125.80000 |
|---|
| LogP | 6.89340 |
|---|
| Index of Refraction | 1.651 |
|---|
| InChIKey | TYKQBZSGHJRQAL-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(S(=O)(=O)Cc2ccccc2)cc1N=Nc1c(O)c(C(=O)Nc2ccccc2)cc2ccccc12 |
|---|
