Introduction：Basic information about CAS 59820-63-2|2-[3-(methylamino)-4-nitrophenoxy]ethanol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[3-(methylamino)-4-nitrophenoxy]ethanol |
|---|
| CAS Number | 59820-63-2 | Molecular Weight | 212.20300 |
|---|
| Density | 1.336g/cm3 | Boiling Point | 432.8ºC at 760 mmHg |
|---|
| Molecular Formula | C9H12N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 215.6ºC |
|---|
Names
| Name | 2-[3-(methylamino)-4-nitrophenoxy]ethanol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.336g/cm3 |
|---|
| Boiling Point | 432.8ºC at 760 mmHg |
|---|
| Molecular Formula | C9H12N2O4 |
|---|
| Molecular Weight | 212.20300 |
|---|
| Flash Point | 215.6ºC |
|---|
| Exact Mass | 212.08000 |
|---|
| PSA | 87.31000 |
|---|
| LogP | 1.60380 |
|---|
| Index of Refraction | 1.612 |
|---|
| InChIKey | IUTYXFLUCZMDMM-UHFFFAOYSA-N |
|---|
| SMILES | CNc1cc(OCCO)ccc1[N+](=O)[O-] |
|---|
Synonyms
| 2-(3-(Methylamino)-4-nitrophenoxy)ethanol |
| 3-Methylamino-4-nitrophenoxyethanol |
| EINECS 261-940-7 |
