Introduction:Basic information about CAS 2669-32-1|3-(dimethoxyphosphinothioylsulfanylmethyl)-5-ethoxy-1,3,4-thiadiazol-2-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(dimethoxyphosphinothioylsulfanylmethyl)-5-ethoxy-1,3,4-thiadiazol-2-one |
|---|
| CAS Number | 2669-32-1 | Molecular Weight | 316.35800 |
|---|
| Density | 1.54g/cm3 | Boiling Point | 362.2ºC at 760mmHg |
|---|
| Molecular Formula | C7H13N2O4PS3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 172.8ºC |
|---|
Names
| Name | lythidathion |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.54g/cm3 |
|---|
| Boiling Point | 362.2ºC at 760mmHg |
|---|
| Molecular Formula | C7H13N2O4PS3 |
|---|
| Molecular Weight | 316.35800 |
|---|
| Flash Point | 172.8ºC |
|---|
| Exact Mass | 315.97800 |
|---|
| PSA | 158.02000 |
|---|
| LogP | 2.56210 |
|---|
| Vapour Pressure | 1.97E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.637 |
|---|
| InChIKey | FPMIAGPUNXEUCZ-UHFFFAOYSA-N |
|---|
| SMILES | CCOc1nn(CSP(=S)(OC)OC)c(=O)s1 |
|---|
Synonyms
| Caswell No. 427C |
| NC-2962 |
| S-5-ethoxy-2,3-dihydro-2-oxo-1,3,4-thiadiazol-3-ylmethyl O,O-dimethyl phosphorodithioate |
| 3-dimethoxyphosphinothioylthiomethyl-5-ethoxy-1,3,4-thiadiazol-2(3H)-one |
| OMS 958 |
| 3-(dimethoxyphosphinothioylsulfanylmethyl)-5-ethoxy-1,3,4-thiadiazol-2-one |
| dithiophosphoric acid S-(5-ethoxy-2-oxo-[1,3,4]thiadiazol-3-ylmethyl) ester O,O'-dimethyl ester |
| o,o-dimethyl-s-[5-ethoxy-1,3,4-thiadiazol-2(3H)-onyl-(3)-methyl]phosphorodithioate |
| Lythidathion |
| Lythidathion [ISO] |
| S-[(5-ethoxy-2-oxo-1,3,4-thiadiazol-3(2H)-yl)methyl] O,O-dimethyl phosphorodithioate |
| ENT 27,238 |