Introduction：Basic information about CAS 144449-86-5|MAGE-1 Antigen (161-169) (human) acetate salt, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | MAGE-1 Antigen (161-169) (human) acetate salt |
|---|
| CAS Number | 144449-86-5 | Molecular Weight | 975.955 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 1627.1±65.0 °C at 760 mmHg |
|---|
| Molecular Formula | C41H57N11O17 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 937.8±34.3 °C |
|---|
Names
| Name | h-glu-ala-asp-pro-thr-gly-his-ser-tyr-oh |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 1627.1±65.0 °C at 760 mmHg |
|---|
| Molecular Formula | C41H57N11O17 |
|---|
| Molecular Weight | 975.955 |
|---|
| Flash Point | 937.8±34.3 °C |
|---|
| Exact Mass | 975.393372 |
|---|
| PSA | 451.30000 |
|---|
| LogP | -1.30 |
|---|
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.618 |
|---|
| InChIKey | UJIAIURNBGXNPB-SRZPNHKFSA-N |
|---|
| SMILES | CC(NC(=O)C(N)CCC(=O)O)C(=O)NC(CC(=O)O)C(=O)N1CCCC1C(=O)NC(C(=O)NCC(=O)NC(Cc1cnc[nH]1)C(=O)NC(CO)C(=O)NC(Cc1ccc(O)cc1)C(=O)O)C(C)O |
|---|
Synonyms
| h2n-eadptghsy-oh |
| L-α-Glutamyl-L-alanyl-L-α-aspartyl-L-prolyl-L-threonylglycyl-L-histidyl-L-seryl-L-tyrosine |
| L-Tyrosine, L-α-glutamyl-L-alanyl-L-α-aspartyl-L-prolyl-L-threonylglycyl-L-histidyl-L-seryl- |
| glu-ala-asp-pro-thr-gly-his-ser-tyr |
