Introduction：Basic information about CAS 380900-00-5|(Ala1)-PAR-4 (1-6) (mouse) trifluoroacetate salt, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (Ala1)-PAR-4 (1-6) (mouse) trifluoroacetate salt |
|---|
| CAS Number | 380900-00-5 | Molecular Weight | 681.779 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 1114.9±65.0 °C at 760 mmHg |
|---|
| Molecular Formula | C34H47N7O8 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 628.1±34.3 °C |
|---|
Names
| Name | (ala1)-par-4 (1-6) (mouse) |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 1114.9±65.0 °C at 760 mmHg |
|---|
| Molecular Formula | C34H47N7O8 |
|---|
| Molecular Weight | 681.779 |
|---|
| Flash Point | 628.1±34.3 °C |
|---|
| Exact Mass | 681.348633 |
|---|
| PSA | 246.28000 |
|---|
| LogP | 0.91 |
|---|
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.600 |
|---|
| InChIKey | VULJVZXXUQIUEM-OZDPOCAXSA-N |
|---|
| SMILES | CC(N)C(=O)NC(Cc1ccc(O)cc1)C(=O)N1CCCC1C(=O)NCC(=O)NC(CCCCN)C(=O)NC(Cc1ccccc1)C(=O)O |
|---|
Synonyms
| h2n-aypgkf-oh |
| L-Phenylalanine, L-alanyl-L-tyrosyl-L-prolylglycyl-L-lysyl- |
| h-ala-tyr-pro-gly-lys-phe-oh |
| aypgkf |
| ala-tyr-pro-gly-lys-phe |
| L-Alanyl-L-tyrosyl-L-prolylglycyl-L-lysyl-L-phenylalanine |
| [Ala1]-PAR-4 (1-6) (mouse) |
