Introduction:Basic information about CAS 129986-67-0|n-methoxy-n-methyl(triphenyl-phosphoranylidene)acetamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | n-methoxy-n-methyl(triphenyl-phosphoranylidene)acetamide |
|---|
| CAS Number | 129986-67-0 | Molecular Weight | 363.38900 |
|---|
| Density | 1.18g/cm3 | Boiling Point | 495.6ºC at 760 mmHg |
|---|
| Molecular Formula | C22H22NO2P | Melting Point | 183ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 253.5ºC |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | n-methoxy-n-methyl(triphenyl-phosphoranylidene)acetamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.18g/cm3 |
|---|
| Boiling Point | 495.6ºC at 760 mmHg |
|---|
| Melting Point | 183ºC |
|---|
| Molecular Formula | C22H22NO2P |
|---|
| Molecular Weight | 363.38900 |
|---|
| Flash Point | 253.5ºC |
|---|
| Exact Mass | 363.13900 |
|---|
| PSA | 39.35000 |
|---|
| LogP | 2.80250 |
|---|
| Vapour Pressure | 5.83E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.612 |
|---|
| InChIKey | DGBLSOOPDBHHRX-UHFFFAOYSA-N |
|---|
| SMILES | CON(C)C(=O)C=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| PPh3PCHCON(Me)OMe2Et |
| (N-methoxymethylaminocarbonylmethylene)triphenylphosphoran |
| Ph3P=CHCON(Me)(OMe) |
| [N-METHOXYMETHYLAMINOCARBONYLMETHYLENE]-TRIPHENYLPHOSPHORANE |
| N-methoxy-N-methyl 2-(triphenylphosphoranylidene) acetamide |
| Ph3P=CHC(O)N(OMe)Me |
| MFCD00134433 |
| N-methoxy-N-methylamino(triphenylphosphoranylidene)acetamide |