Introduction：Basic information about CAS 55494-04-7|Bis(trimethylsilyl) 2-methylenesuccinate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Bis(trimethylsilyl) 2-methylenesuccinate |
|---|
| CAS Number | 55494-04-7 | Molecular Weight | 274.461 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 258.1±23.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H22O4Si2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 91.4±18.2 °C |
|---|
Names
| Name | bis(trimethylsilyl) 2-methylidenebutanedioate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 258.1±23.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H22O4Si2 |
|---|
| Molecular Weight | 274.461 |
|---|
| Flash Point | 91.4±18.2 °C |
|---|
| Exact Mass | 274.105652 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 3.46 |
|---|
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.432 |
|---|
| InChIKey | IYEWOPPVIQNFQO-UHFFFAOYSA-N |
|---|
| SMILES | C=C(CC(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C |
|---|
Safety Information
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
Synonyms
| Methylenebutanedioic acid bis(trimethylsilyl) ester |
| Butanedioic acid, methylene-, bis(trimethylsilyl) ester |
| Butanedioic acid,methylene-,bis(trimethylsilyl) ester |
| Bis(trimethylsilyl)-2-methylenbutandioat |
| Itaconic acid (tms) |
| Butanedioic acid, 2-methylene-, bis(trimethylsilyl) ester |
| Bis(trimethylsilyl)itaconate |
| Bis(trimethylsilyl) 2-methylenesuccinate |
