Introduction：Basic information about CAS 42019-78-3|4-p-Chlorobenzoylphenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-p-Chlorobenzoylphenol |
|---|
| CAS Number | 42019-78-3 | Molecular Weight | 232.662 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 404.0±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H9ClO2 | Melting Point | 177-181 °C |
|---|
| MSDS | / | Flash Point | 198.1±24.6 °C |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 4-Chloro-4'-hydroxybenzophenone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 404.0±30.0 °C at 760 mmHg |
|---|
| Melting Point | 177-181 °C |
|---|
| Molecular Formula | C13H9ClO2 |
|---|
| Molecular Weight | 232.662 |
|---|
| Flash Point | 198.1±24.6 °C |
|---|
| Exact Mass | 232.029114 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 3.59 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.624 |
|---|
| InChIKey | RUETVLNXAGWCDS-UHFFFAOYSA-N |
|---|
| SMILES | O=C(c1ccc(O)cc1)c1ccc(Cl)cc1 |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P305 + P351 + P338 |
|---|
| Hazard Codes | Xi,Xn |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S24/25-S37/39-S26 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2914700090 |
|---|
Customs
| HS Code | 2914700090 |
|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| Fenofibrate impurity A |
| 4-Chloro-4`-hydroxybenzophenone |
| 4,4'-Chlorohydroxybenzophenone |
| 4-Chloro-4'-hydroxyb |
| 4-p-Chlorobenzoylphenol |
| EINECS 255-627-4 |
| Fenofibrate Related Compound A |
| Methanone, (4-chlorophenyl)(4-hydroxyphenyl)- |
| 4-Chloro-4’-hydroxybenzophenone |
| MFCD00002357 |
| (4-Chlorophenyl)(4-hydroxyphenyl)methanone |
| 4-chlorophenyl 4-hydroxyphenyl ketone |
| 4-Chloro-4'-hydroxybenzophenone |
| 4-Chloro-4'-hydroxybenzophenon |
| 4-Hydroxy-4'-chlorobenzophenone |
| 4-Chloro-4-Hydroxybenzophenone |
