Introduction:Basic information about CAS 99-21-8|Benzamide,N-(4-amino-5-methoxy-2-methylphenyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzamide,N-(4-amino-5-methoxy-2-methylphenyl)- |
|---|
| CAS Number | 99-21-8 | Molecular Weight | 256.30000 |
|---|
| Density | 1.215 g/cm3 | Boiling Point | 344.3ºC at 760 mmHg |
|---|
| Molecular Formula | C15H16N2O2 | Melting Point | 185-188ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 162ºC |
|---|
Names
| Name | n-(4-amino-5-methoxy-2-methylphenyl)benzamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.215 g/cm3 |
|---|
| Boiling Point | 344.3ºC at 760 mmHg |
|---|
| Melting Point | 185-188ºC |
|---|
| Molecular Formula | C15H16N2O2 |
|---|
| Molecular Weight | 256.30000 |
|---|
| Flash Point | 162ºC |
|---|
| Exact Mass | 256.12100 |
|---|
| PSA | 64.35000 |
|---|
| LogP | 3.49230 |
|---|
| Index of Refraction | 1.646 |
|---|
| InChIKey | VENDXQNWODZJGB-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(NC(=O)c2ccccc2)c(C)cc1N |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Safety Phrases | 24/25 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| 2-methoxy-4-benzoylamino-5-methyl-aniline |
| fastvioletb |
| benzoic acid-(4-amino-5-methoxy-2-methyl-anilide) |
| EINECS 202-740-1 |
| Benzamide,N-(4-amino-5-methoxy-2-methylphenyl) |
| 2-amino-4-methyl-5-benzoylamino-anisol |
| 5-Methoxy-2-methyl-N1-benzoyl-p-phenylendiamin |
| MFCD00064435 |
| Benzoesaeure-(4-amino-5-methoxy-2-methyl-anilid) |
| 2-methoxy-5-methyl-4-benzoylaminoaniline |