Introduction：Basic information about CAS 67525-66-0|beta-D-Ribofuranose,2,3,5-tribenzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | beta-D-Ribofuranose,2,3,5-tribenzoate |
|---|
| CAS Number | 67525-66-0 | Molecular Weight | 462.44800 |
|---|
| Density | 1.37 g/cm3 | Boiling Point | 619.8ºC at 760 mmHg |
|---|
| Molecular Formula | C26H22O8 | Melting Point | 189-192ºC |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | β-D-Ribofuranose 2,3,5-tribenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.37 g/cm3 |
|---|
| Boiling Point | 619.8ºC at 760 mmHg |
|---|
| Melting Point | 189-192ºC |
|---|
| Molecular Formula | C26H22O8 |
|---|
| Molecular Weight | 462.44800 |
|---|
| Exact Mass | 462.13100 |
|---|
| PSA | 108.36000 |
|---|
| LogP | 3.01180 |
|---|
| Index of Refraction | 1.633 |
|---|
| InChIKey | VJYJDSXEIXFNRI-PIXQIBFHSA-N |
|---|
| SMILES | O=C(OCC1OC(O)C(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1)c1ccccc1 |
|---|
Synonyms
| 1-O-Acetyl-2,3,5-tri-O-benzoyl-D-ribofuranose |
| 2,3,5-tri-O-benzoyl-1-O-acetylribofuranose |
| 1-O-acetyl-2,3,5-tri-O-benzoylribofuranose |
| 1-O-Acetyl-2,3,5-tri-O-benzoylribose |
