Introduction：Basic information about CAS 70321-85-6|4-(N-Acetylacetamido)benzenesulfonate potassium salt, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(N-Acetylacetamido)benzenesulfonate potassium salt |
|---|
| CAS Number | 70321-85-6 | Molecular Weight | 295.35300 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C10H10KNO5S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Potassium 4-acetoacetylaminobenzenesulfonate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C10H10KNO5S |
|---|
| Molecular Weight | 295.35300 |
|---|
| Exact Mass | 294.99200 |
|---|
| PSA | 111.75000 |
|---|
| LogP | 1.66210 |
|---|
| InChIKey | FNLKZYBTJKUMQM-UHFFFAOYSA-M |
|---|
| SMILES | CC(=O)CC(=O)Nc1ccc(S(=O)(=O)[O-])cc1.[K+] |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| N-(Acetoacetyl)sulfanilic acid,potassium salt |
| 4-(N-Acetylacetamido)-benzenesulfonic acid potassium salt |
| 4-(N-Acetyl Acetamido)-Benzenesulfonate Potassium Salt |
| 4-(Acetoacetylamino)benzenesulfonic acid potassium salt |
| 4-[(1,3-dioxobutyl)amino]-benzenesulfonic acimonopotassium salt |
| p-acetoacetylaminobenzenesulfonic acid potassium salt |
| potassium 4-acetoacetylaminobenzenesulphonate |
| Benzenesulfonic acid,4-[(1,3-dioxo butyl)amino]-,monopotassium salt |
| 4-Acetoacetsulfanilic acid potassium salt |
