Introduction:Basic information about CAS 21752-36-3|(S)-(-)-N-(α-Methylbenzyl)phthalamic Acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (S)-(-)-N-(α-Methylbenzyl)phthalamic Acid |
|---|
| CAS Number | 21752-36-3 | Molecular Weight | 269.29500 |
|---|
| Density | 1.222 g/cm3 | Boiling Point | 500.3ºC at 760 mmHg |
|---|
| Molecular Formula | C16H15NO3 | Melting Point | 128-130 °C |
|---|
| MSDS | ChineseUSA | Flash Point | 256.3ºC |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | (s)-(-)-n-(1-phenylethyl)phthalamic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.222 g/cm3 |
|---|
| Boiling Point | 500.3ºC at 760 mmHg |
|---|
| Melting Point | 128-130 °C |
|---|
| Molecular Formula | C16H15NO3 |
|---|
| Molecular Weight | 269.29500 |
|---|
| Flash Point | 256.3ºC |
|---|
| Exact Mass | 269.10500 |
|---|
| PSA | 66.40000 |
|---|
| LogP | 3.26670 |
|---|
| Vapour Pressure | 7.92E-11mmHg at 25°C |
|---|
| Index of Refraction | -46 ° (C=2, EtOH) |
|---|
| InChIKey | VCFKXWGKKDZMPO-NSHDSACASA-N |
|---|
| SMILES | CC(NC(=O)c1ccccc1C(=O)O)c1ccccc1 |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| (S)-(-)-N-(1-Phenylethyl)phthalamic Acid |
| (S)-(-)-N-(alpha-Methylbenzyl)phthalaMic Acid |
| forresolutionofracemates |
| (S)-(-)-N-(α-Methylbenzyl)phthalamic Acid |
| 2-[[[(1S)-1-Phenylethyl]Amino]Carbonyl]-Benzoic Acid |
| (S)-2-(1-phenylethylcarbamoyl)benzoic acid |
| N-((S)-1-phenylethyl)phthalamic acid |
| (S)-o-{[(1-phenylethyl)amino]carbonyl}benzoic acid |
| (S)-(1-PHENYLETHYL)PHTHALAMIC ACID |
| Einecs 244-571-6 |
| N-((S)-1-Phenyl-aethyl)-phthalamidsaeure |
| MFCD00013979 |
| (-)-N-(1-PHENYLETHYL)PHTHALIC ACID MONOAMIDE |
| (S)-(-)-N-(A-Methylbenzyl)phthalamidicacid |
| (S)-2-((1-Phenylethyl)carbamoyl)benzoic acid |