Introduction:Basic information about CAS 843-33-4|4-(4-nitrophenylazo)catechol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(4-nitrophenylazo)catechol |
|---|
| CAS Number | 843-33-4 | Molecular Weight | 259.21800 |
|---|
| Density | 1.45g/cm3 | Boiling Point | 351.8ºC at 760 mmHg |
|---|
| Molecular Formula | C12H9N3O4 | Melting Point | 188-190°C |
|---|
| MSDS | / | Flash Point | 166.5ºC |
|---|
Names
| Name | 4-[2-(4-nitrophenyl)hydrazinyl]cyclohexa-3,5-diene-1,2-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.45g/cm3 |
|---|
| Boiling Point | 351.8ºC at 760 mmHg |
|---|
| Melting Point | 188-190°C |
|---|
| Molecular Formula | C12H9N3O4 |
|---|
| Molecular Weight | 259.21800 |
|---|
| Flash Point | 166.5ºC |
|---|
| Exact Mass | 259.05900 |
|---|
| PSA | 111.00000 |
|---|
| LogP | 3.94460 |
|---|
| Index of Refraction | 1.661 |
|---|
| InChIKey | DGOZWUSVOBKXNR-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc(N=Nc2ccc(O)c(O)c2)cc1 |
|---|
Safety Information
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | S26-S36/37/39 |
|---|
| HS Code | 2927000090 |
|---|
Customs
| HS Code | 2927000090 |
|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 4-(4-Nitrophenylazo)catechol |
| 4-[(4-nitrophenyl)azo]-1,2-benzenediol |
| 4'-Nitro-3.4-dioxy-azobenzol |
| 4-[(4-nitrophenyl)diazenyl]-1,2-benzenediol |
| (4-Nitro-benzol)-(1 azo 4)-brenzcatechin |
| 4-(4-nitro-phenylazo)-pyrocatechol |
| 4-(4-Nitro-phenylazo)-brenzcatechin |
| MFCD00014711 |
| 4-(4-Nitrobenzeneazo) catechol |
| EINECS 212-676-6 |