Introduction：Basic information about CAS 4098-30-0|Dodecamethylhexasilinane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Dodecamethylhexasilinane |
|---|
| CAS Number | 4098-30-0 | Molecular Weight | 348.927 |
|---|
| Density | 0.8±0.1 g/cm3 | Boiling Point | 263.9±23.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H36Si6 | Melting Point | 229ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 81.3±15.6 °C |
|---|
Names
| Name | 1,1,2,2,3,3,4,4,5,5,6,6-dodecamethylhexasilinane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.8±0.1 g/cm3 |
|---|
| Boiling Point | 263.9±23.0 °C at 760 mmHg |
|---|
| Melting Point | 229ºC(lit.) |
|---|
| Molecular Formula | C12H36Si6 |
|---|
| Molecular Weight | 348.927 |
|---|
| Flash Point | 81.3±15.6 °C |
|---|
| Exact Mass | 348.143250 |
|---|
| LogP | 4.72080 |
|---|
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.426 |
|---|
| InChIKey | RTCLHEHPUHREBC-UHFFFAOYSA-N |
|---|
| SMILES | C[Si]1(C)[Si](C)(C)[Si](C)(C)[Si](C)(C)[Si](C)(C)[Si]1(C)C |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| Hazard Codes | Xn |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2901100000 |
|---|
Customs
| HS Code | 2901100000 |
|---|
| Summary | 2901100000 saturated acyclic hydrocarbons。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:2.0%。General tariff:30.0% |
|---|
Synonyms
| Cyclohexasilane,dodecamethyl |
| dodecamethyl-hexasilinane |
| EINECS 223-860-0 |
| Cyclohexasilane, dodecamethyl- |
| dodecamethylcyclohexasilane |
| MFCD00053564 |
| Dodecamethylhexasilinane |
| dodecamethylcyclohexalsilane |
| Dodecamethylcyclohexasilan |
