Introduction:Basic information about CAS 14009-24-6|Drotaverin hydrochloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Drotaverin hydrochloride |
|---|
| CAS Number | 14009-24-6 | Molecular Weight | 397.50700 |
|---|
| Density | 1.097 g/cm3 | Boiling Point | 564ºC at 760 mmHg |
|---|
| Molecular Formula | C24H31NO4 | Melting Point | 184 -188ºC |
|---|
| MSDS | / | Flash Point | 240.7ºC |
|---|
Names
| Name | (1Z)-1-[(3,4-diethoxyphenyl)methylidene]-6,7-diethoxy-3,4-dihydro-2H-isoquinoline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.097 g/cm3 |
|---|
| Boiling Point | 564ºC at 760 mmHg |
|---|
| Melting Point | 184 -188ºC |
|---|
| Molecular Formula | C24H31NO4 |
|---|
| Molecular Weight | 397.50700 |
|---|
| Flash Point | 240.7ºC |
|---|
| Exact Mass | 397.22500 |
|---|
| PSA | 48.95000 |
|---|
| LogP | 5.25400 |
|---|
| Vapour Pressure | 9.61E-13mmHg at 25°C |
|---|
| InChIKey | OMFNSKIUKYOYRG-MOSHPQCFSA-N |
|---|
| SMILES | CCOc1ccc(C=C2NCCc3cc(OCC)c(OCC)cc32)cc1OCC |
|---|
Safety Information
Customs
| HS Code | 2933499090 |
|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| drotaverine |
| Drotaverinum [INN-Latin] |
| No-Spa |
| MFCD00347721 |
| Drotaverina [INN-Spanish] |
| dihydroisoperparine |
| Drotin |
| Drotaverine [INN] |
| Drotaverin |