Introduction:Basic information about CAS 91-77-0|1,3,5-Triazine-2,4,6-triamine,N2,N2-di-2-propen-1-yl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,3,5-Triazine-2,4,6-triamine,N2,N2-di-2-propen-1-yl- |
|---|
| CAS Number | 91-77-0 | Molecular Weight | 206.24800 |
|---|
| Density | 1.228g/cm3 | Boiling Point | 438.1ºC at 760 mmHg |
|---|
| Molecular Formula | C9H14N6 | Melting Point | 140-142ºC |
|---|
| MSDS | / | Flash Point | 218.7ºC |
|---|
Names
| Name | 2-N,2-N-bis(prop-2-enyl)-1,3,5-triazine-2,4,6-triamine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.228g/cm3 |
|---|
| Boiling Point | 438.1ºC at 760 mmHg |
|---|
| Melting Point | 140-142ºC |
|---|
| Molecular Formula | C9H14N6 |
|---|
| Molecular Weight | 206.24800 |
|---|
| Flash Point | 218.7ºC |
|---|
| Exact Mass | 206.12800 |
|---|
| PSA | 93.95000 |
|---|
| LogP | 1.37680 |
|---|
| Index of Refraction | 1.65 |
|---|
| InChIKey | ROHTVIURAJBDES-UHFFFAOYSA-N |
|---|
| SMILES | C=CCN(CC=C)c1nc(N)nc(N)n1 |
|---|
Safety Information
| Risk Phrases | 20/21/22-36/37/38 |
|---|
| Safety Phrases | 22-36/37/39 |
|---|
| HS Code | 2933699090 |
|---|
Customs
| HS Code | 2933699090 |
|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
|---|
Synonyms
| 2,4-Diamino-6-diallylamino-1,3,5-triazine |
| N,N-di-2-propenyl-[1,3,5]triazine-2,4,6-triamine |
| N,N-Diallylmelamine |
| Melamine,N2-diallyl |
| N2,N2-Diallylmelamine |
| diallyl(4,6-diamino-1,3,5-triazin-2-yl)amine |
| EINECS 202-096-1 |
| Diallylmelamine |
| N2,N2-diallyl-[1,3,5]triazine-2,4,6-triyltriamine |
| N2,N2-Diallyl-[1,3,5]triazin-2,4,6-triyltriamin |