Introduction：Basic information about CAS 90861-52-2|5-Methyl-3-(4-methylphenyl)-1H-pyrazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Methyl-3-(4-methylphenyl)-1H-pyrazole |
|---|
| CAS Number | 90861-52-2 | Molecular Weight | 172.226 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 342.3±11.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H12N2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 157.2±12.2 °C |
|---|
Names
| Name | 5-methyl-3-p-tolyl-1h-pyrazole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 342.3±11.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H12N2 |
|---|
| Molecular Weight | 172.226 |
|---|
| Flash Point | 157.2±12.2 °C |
|---|
| Exact Mass | 172.100052 |
|---|
| PSA | 28.68000 |
|---|
| LogP | 3.14 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.582 |
|---|
| InChIKey | GCBXABQYUJKQHX-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(-c2cc(C)[nH]n2)cc1 |
|---|
Synonyms
| 1H-Pyrazole, 5-methyl-3-(4-methylphenyl)- |
| 5-Methyl-3-(4-methylphenyl)-1H-pyrazole |
| 3-Methyl-5-p-tolyl-1H-pyrazole |
| 1H-2-amino-4-toluoylpyrazole |
