Introduction：Basic information about CAS 2140-11-6|2',3'-O-Isopropylideneinosine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2',3'-O-Isopropylideneinosine |
|---|
| CAS Number | 2140-11-6 | Molecular Weight | 308.290 |
|---|
| Density | 1.9±0.1 g/cm3 | Boiling Point | 600.4±65.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H16N4O5 | Melting Point | 263-272°C |
|---|
| MSDS | / | Flash Point | 316.9±34.3 °C |
|---|
Names
| Name | 2',3'-O-Isopropylideneinosine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.9±0.1 g/cm3 |
|---|
| Boiling Point | 600.4±65.0 °C at 760 mmHg |
|---|
| Melting Point | 263-272°C |
|---|
| Molecular Formula | C13H16N4O5 |
|---|
| Molecular Weight | 308.290 |
|---|
| Flash Point | 316.9±34.3 °C |
|---|
| Exact Mass | 308.112061 |
|---|
| PSA | 111.49000 |
|---|
| LogP | -0.02 |
|---|
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.829 |
|---|
| InChIKey | LIEKLUBCIPVWQD-WURNFRPNSA-N |
|---|
| SMILES | CC1(C)OC2C(CO)OC(n3cnc4c(=O)[nH]cnc43)C2O1 |
|---|
| Storage condition | -20°C Freezer |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| 2'-O,3'-O-Isopropylidene-2-deaminoguanosine |
| 2',3'-O-(1-Methylethylidene)-Inosine |
| 2',3'-di-O-isopropylideneinosine |
| 2',3'-O-isopropyrideneinosine |
| 9-(2,3-O-Isopropylidene- |
| MFCD00038002 |
| 2,3-O-Isopropylideneinosine |
| EINECS 218-388-7 |
| 2',3'-O-isopropylideninosine |
| 2′,3′-O-Isopropylideneinosine |
| 2',3'-Isopropylideneinosine |
| 2'-O,3'-O-Isopropylideneinosine |
