Introduction:Basic information about CAS 14432-16-7|2-Chloro-4-nitropyridine 1-oxide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Chloro-4-nitropyridine 1-oxide |
|---|
| CAS Number | 14432-16-7 | Molecular Weight | 174.542 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 405.9±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C5H3ClN2O3 | Melting Point | 52-56 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 199.3±23.2 °C |
|---|
| Symbol | GHS06 | Signal Word | Danger |
|---|
Names
| Name | 2-Chloro-4-nitropyridine N-oxide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 405.9±25.0 °C at 760 mmHg |
|---|
| Melting Point | 52-56 °C(lit.) |
|---|
| Molecular Formula | C5H3ClN2O3 |
|---|
| Molecular Weight | 174.542 |
|---|
| Flash Point | 199.3±23.2 °C |
|---|
| Exact Mass | 173.983215 |
|---|
| PSA | 71.28000 |
|---|
| LogP | 0.14 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.629 |
|---|
| InChIKey | YSTCMHHKDOVZDA-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1cc[n+]([O-])c(Cl)c1 |
|---|
Safety Information
| Symbol | GHS06 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H301-H311-H315-H319-H331-H335 |
|---|
| Precautionary Statements | P261-P280-P301 + P310-P305 + P351 + P338-P311 |
|---|
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
|---|
| Hazard Codes | T:Toxic; |
|---|
| Risk Phrases | R23/24/25;R36/37/38 |
|---|
| Safety Phrases | S26-S36-S45-S36/37/39-S28 |
|---|
| RIDADR | UN 2811 6.1/PG 3 |
|---|
| WGK Germany | 3 |
|---|
| Hazard Class | 6.1 |
|---|
| HS Code | 2942000000 |
|---|
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 2-Chloro-4-nitropyridine 1-oxide |
| 2-chloro-4-nitro-1-oxidopyridin-1-ium |
| Pyridine, 2-chloro-4-nitro-, 1-oxide |
| EINECS 238-404-6 |
| MFCD00661454 |
| 2-Chloro-4-nitropyridine N-oxide |
| 2-Chloro-4-nitropyridine-1-oxide |
| 2-Chloro-4-nitropyridine-1-oxyde |