Introduction:Basic information about CAS 87129-71-3|ARMILLARISIN A, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ARMILLARISIN A |
|---|
| CAS Number | 87129-71-3 | Molecular Weight | 253.33700 |
|---|
| Density | 1.07 g/cm3 | Boiling Point | 395.5ºC at 760 mmHg |
|---|
| Molecular Formula | C14H23NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 193ºC |
|---|
Names
| Name | 3-amino-1-[4-(2-methoxyethyl)phenoxy]-3-methylbutan-2-ol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.07 g/cm3 |
|---|
| Boiling Point | 395.5ºC at 760 mmHg |
|---|
| Molecular Formula | C14H23NO3 |
|---|
| Molecular Weight | 253.33700 |
|---|
| Flash Point | 193ºC |
|---|
| Exact Mass | 253.16800 |
|---|
| PSA | 64.71000 |
|---|
| LogP | 2.05280 |
|---|
| Index of Refraction | 1.523 |
|---|
| InChIKey | LAWLHMWODZUZJH-UHFFFAOYSA-N |
|---|
| SMILES | COCCc1ccc(OCC(O)C(C)(C)N)cc1 |
|---|
Synonyms
| Arnolol |
| UNII-98HS077RUP |
| Arnololum |