Introduction：Basic information about CAS 99485-76-4|cumyluron, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | cumyluron |
|---|
| CAS Number | 99485-76-4 | Molecular Weight | 220.26800 |
|---|
| Density | 1.164 g/cm3 | Boiling Point | 503ºC at 760 mmHg |
|---|
| Molecular Formula | C12H16N2O2 | Melting Point | / |
|---|
| MSDS | USA | Flash Point | 258ºC |
|---|
Names
| Name | cumyluron |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.164 g/cm3 |
|---|
| Boiling Point | 503ºC at 760 mmHg |
|---|
| Molecular Formula | C12H16N2O2 |
|---|
| Molecular Weight | 220.26800 |
|---|
| Flash Point | 258ºC |
|---|
| Exact Mass | 220.12100 |
|---|
| PSA | 41.57000 |
|---|
| LogP | 2.66500 |
|---|
| Index of Refraction | 1.575 |
|---|
| InChIKey | VYNOULHXXDFBLU-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(NC(=O)NCc1ccccc1Cl)c1ccccc1 |
|---|
| Storage condition | 0-6°C |
|---|
Safety Information
| Hazard Statements | H412 |
|---|
| Precautionary Statements | P273 |
|---|
| Hazard Codes | Xn |
|---|
| Risk Phrases | 52/53 |
|---|
| Safety Phrases | 61 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| 1-[(2-chlorophenyl)methyl]-3-(2-phenylpropan-2-yl)urea |
| Cumyluron |
| Cumyluron [ISO] |
| Urea,N-[(2-chlorophenyl)methyl]-N'-(1-methyl-1-phenylethyl) |
| N-[(2-chlorophenyl)methyl]-N’-(1-methyl-1-phenylethyl)urea |
| cumyleron |
| 1-(2-chlorobenzyl)-3-(1-methyl-1-phenylethyl)urea |
| N-[(2-chlorophenyl)methyl]-N’-(2-phenylpropan-2-yl)urea |
