Introduction：Basic information about CAS 19550-60-8|Octane, 3,7-dimethyl-1-(2,5-xylyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Octane, 3,7-dimethyl-1-(2,5-xylyl)- |
|---|
| CAS Number | 19550-60-8 | Molecular Weight | 246.431 |
|---|
| Density | 0.9±0.1 g/cm3 | Boiling Point | 326.2±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C18H30 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 147.1±7.8 °C |
|---|
Names
| Name | 2-(3,7-dimethyloctyl)-1,4-dimethylbenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.9±0.1 g/cm3 |
|---|
| Boiling Point | 326.2±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C18H30 |
|---|
| Molecular Weight | 246.431 |
|---|
| Flash Point | 147.1±7.8 °C |
|---|
| Exact Mass | 246.234756 |
|---|
| LogP | 8.01 |
|---|
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.485 |
|---|
| InChIKey | GDGPOTBJJLOPRZ-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(C)c(CCC(C)CCCC(C)C)c1 |
|---|
Synonyms
| 2-(3,7-Dimethyloctyl)-1,4-dimethylbenzene |
| 1,4-Dimethyl-2-(3,7-dimethyloctyl)benzene |
| Octane, 3,7-dimethyl-1- (2,5-xylyl)- |
| 1,7-dimethyloctyl)benzene |
| Octane, 3,7-dimethyl-1-(2,5-xylyl)- |
| Benzene, 2-(3,7-dimethyloctyl)-1,4-dimethyl- |
