Introduction：Basic information about CAS 959243-57-3|Methanone, (3-ethyl-5-methyl-4-isoxazolyl)[4-(2-methylphenyl)-1-piperazinyl], including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methanone, (3-ethyl-5-methyl-4-isoxazolyl)[4-(2-methylphenyl)-1-piperazinyl] |
|---|
| CAS Number | 959243-57-3 | Molecular Weight | 313.39400 |
|---|
| Density | 1.156g/cm3 | Boiling Point | 520.678ºC at 760 mmHg |
|---|
| Molecular Formula | C18H23N3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 268.697ºC |
|---|
Names
| Name | Methanone, (3-ethyl-5-methyl-4-isoxazolyl)[4-(2-methylphenyl)-1-piperazinyl] |
|---|
Chemical & Physical Properties
| Density | 1.156g/cm3 |
|---|
| Boiling Point | 520.678ºC at 760 mmHg |
|---|
| Molecular Formula | C18H23N3O2 |
|---|
| Molecular Weight | 313.39400 |
|---|
| Flash Point | 268.697ºC |
|---|
| Exact Mass | 313.17900 |
|---|
| PSA | 49.58000 |
|---|
| LogP | 2.81910 |
|---|
| Index of Refraction | 1.572 |
|---|
| InChIKey | FOQLAVZWABOYOB-UHFFFAOYSA-N |
|---|
| SMILES | CCc1noc(C)c1C(=O)N1CCN(c2ccccc2C)CC1 |
|---|
