Introduction:Basic information about CAS 866789-39-1|Methanone, (3,5-dimethyl-4-isoxazolyl)[4-[2-nitro-4-(trifluoromethyl)phenyl]-1-piper, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methanone, (3,5-dimethyl-4-isoxazolyl)[4-[2-nitro-4-(trifluoromethyl)phenyl]-1-piperazinyl]- |
|---|
| CAS Number | 866789-39-1 | Molecular Weight | 398.33600 |
|---|
| Density | 1.404g/cm3 | Boiling Point | 562.353ºC at 760 mmHg |
|---|
| Molecular Formula | C17H17F3N4O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 293.901ºC |
|---|
Names
| Name | Methanone, (3,5-dimethyl-4-isoxazolyl)[4-[2-nitro-4-(trifluoromethyl)phenyl]-1-piperazinyl] |
|---|
Chemical & Physical Properties
| Density | 1.404g/cm3 |
|---|
| Boiling Point | 562.353ºC at 760 mmHg |
|---|
| Molecular Formula | C17H17F3N4O4 |
|---|
| Molecular Weight | 398.33600 |
|---|
| Flash Point | 293.901ºC |
|---|
| Exact Mass | 398.12000 |
|---|
| PSA | 95.40000 |
|---|
| LogP | 3.70690 |
|---|
| Index of Refraction | 1.556 |
|---|
| InChIKey | LJTICHFRUOMKSZ-UHFFFAOYSA-N |
|---|
| SMILES | Cc1noc(C)c1C(=O)N1CCN(c2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC1 |
|---|