Introduction：Basic information about CAS 850215-28-0|Methanone, (3,5-dimethyl-4-isoxazolyl)[4-(3-methoxyphenyl)-1-piperazinyl]-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methanone, (3,5-dimethyl-4-isoxazolyl)[4-(3-methoxyphenyl)-1-piperazinyl]- |
|---|
| CAS Number | 850215-28-0 | Molecular Weight | 315.36700 |
|---|
| Density | 1.202g/cm3 | Boiling Point | 540.7ºC at 760 mmHg |
|---|
| Molecular Formula | C17H21N3O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 280.8ºC |
|---|
Names
| Name | Methanone, (3,5-dimethyl-4-isoxazolyl)[4-(3-methoxyphenyl)-1-piperazinyl] |
|---|
Chemical & Physical Properties
| Density | 1.202g/cm3 |
|---|
| Boiling Point | 540.7ºC at 760 mmHg |
|---|
| Molecular Formula | C17H21N3O3 |
|---|
| Molecular Weight | 315.36700 |
|---|
| Flash Point | 280.8ºC |
|---|
| Exact Mass | 315.15800 |
|---|
| PSA | 58.81000 |
|---|
| LogP | 2.26530 |
|---|
| Index of Refraction | 1.572 |
|---|
| InChIKey | SPQQXDJFLGLBSZ-UHFFFAOYSA-N |
|---|
| SMILES | COc1cccc(N2CCN(C(=O)c3c(C)noc3C)CC2)c1 |
|---|
