Introduction：Basic information about CAS 801224-44-2|Methanone, [4-(4-methoxyphenyl)-1-piperazinyl](5-methyl-3-phenyl-4-isoxazolyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methanone, [4-(4-methoxyphenyl)-1-piperazinyl](5-methyl-3-phenyl-4-isoxazolyl)- |
|---|
| CAS Number | 801224-44-2 | Molecular Weight | 377.43600 |
|---|
| Density | 1.212g/cm3 | Boiling Point | 624.6ºC at 760 mmHg |
|---|
| Molecular Formula | C22H23N3O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 331.5ºC |
|---|
Names
| Name | Methanone, [4-(4-methoxyphenyl)-1-piperazinyl](5-methyl-3-phenyl-4-isoxazolyl) |
|---|
Chemical & Physical Properties
| Density | 1.212g/cm3 |
|---|
| Boiling Point | 624.6ºC at 760 mmHg |
|---|
| Molecular Formula | C22H23N3O3 |
|---|
| Molecular Weight | 377.43600 |
|---|
| Flash Point | 331.5ºC |
|---|
| Exact Mass | 377.17400 |
|---|
| PSA | 58.81000 |
|---|
| LogP | 3.62390 |
|---|
| Index of Refraction | 1.597 |
|---|
| InChIKey | QOEOKUAZHXOIRZ-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(N2CCN(C(=O)c3c(-c4ccccc4)noc3C)CC2)cc1 |
|---|
