Introduction:Basic information about CAS 683206-20-4|Methanone, [3-(2,6-dichlorophenyl)-5-methyl-4-isoxazolyl][4-[4-nitro-2-(1H-pyrrol-1-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methanone, [3-(2,6-dichlorophenyl)-5-methyl-4-isoxazolyl][4-[4-nitro-2-(1H-pyrrol-1-yl)phenyl]-1-piperazinyl]- |
|---|
| CAS Number | 683206-20-4 | Molecular Weight | 526.37100 |
|---|
| Density | 1.47g/cm3 | Boiling Point | 735.8ºC at 760 mmHg |
|---|
| Molecular Formula | C25H21Cl2N5O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 398.8ºC |
|---|
Names
| Name | Methanone, [3-(2,6-dichlorophenyl)-5-methyl-4-isoxazolyl][4-[4-nitro-2-(1H-pyrrol-1-yl)phenyl]-1-piperazinyl] |
|---|
Chemical & Physical Properties
| Density | 1.47g/cm3 |
|---|
| Boiling Point | 735.8ºC at 760 mmHg |
|---|
| Molecular Formula | C25H21Cl2N5O4 |
|---|
| Molecular Weight | 526.37100 |
|---|
| Flash Point | 398.8ºC |
|---|
| Exact Mass | 525.09700 |
|---|
| PSA | 100.33000 |
|---|
| LogP | 6.14420 |
|---|
| Index of Refraction | 1.695 |
|---|
| InChIKey | AQCXSGQNNQWCSF-UHFFFAOYSA-N |
|---|
| SMILES | Cc1onc(-c2c(Cl)cccc2Cl)c1C(=O)N1CCN(c2ccc([N+](=O)[O-])cc2-n2cccc2)CC1 |
|---|