Introduction：Basic information about CAS 847865-44-5|1H-Indole-3-acetonitrile, 5-fluoro-a,a-dimethyl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1H-Indole-3-acetonitrile, 5-fluoro-a,a-dimethyl |
|---|
| CAS Number | 847865-44-5 | Molecular Weight | 202.22800 |
|---|
| Density | 1.217g/cm3 | Boiling Point | 372.3ºC at 760 mmHg |
|---|
| Molecular Formula | C12H11FN2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 179ºC |
|---|
Names
| Name | 1H-Indole-3-acetonitrile, 5-fluoro-a,a-dimethyl |
|---|
Chemical & Physical Properties
| Density | 1.217g/cm3 |
|---|
| Boiling Point | 372.3ºC at 760 mmHg |
|---|
| Molecular Formula | C12H11FN2 |
|---|
| Molecular Weight | 202.22800 |
|---|
| Flash Point | 179ºC |
|---|
| Exact Mass | 202.09100 |
|---|
| PSA | 39.58000 |
|---|
| LogP | 3.10818 |
|---|
| Index of Refraction | 1.599 |
|---|
| InChIKey | VDRHNESUBDLGFY-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C#N)c1c[nH]c2ccc(F)cc12 |
|---|
