Introduction：Basic information about CAS 202858-60-4|3-Pyridinecarboxaldehyde, 5-ethenyl-4-[4-fluoro-2-(phenylmethoxy)phenyl]-2,6-bis(1-m, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Pyridinecarboxaldehyde, 5-ethenyl-4-[4-fluoro-2-(phenylmethoxy)phenyl]-2,6-bis(1-methylethyl)- |
|---|
| CAS Number | 202858-60-4 | Molecular Weight | 417.51500 |
|---|
| Density | 1.114g/cm3 | Boiling Point | 525.4ºC at 760 mmHg |
|---|
| Molecular Formula | C27H28FNO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 271.5ºC |
|---|
Names
| Name | 3-Pyridinecarboxaldehyde, 5-ethenyl-4-[4-fluoro-2-(phenylmethoxy)phenyl]-2,6-bis(1-methylethyl) |
|---|
Chemical & Physical Properties
| Density | 1.114g/cm3 |
|---|
| Boiling Point | 525.4ºC at 760 mmHg |
|---|
| Molecular Formula | C27H28FNO2 |
|---|
| Molecular Weight | 417.51500 |
|---|
| Flash Point | 271.5ºC |
|---|
| Exact Mass | 417.21000 |
|---|
| PSA | 39.19000 |
|---|
| LogP | 7.16900 |
|---|
| Vapour Pressure | 3.95E-11mmHg at 25°C |
|---|
| Index of Refraction | 1.588 |
|---|
| InChIKey | JFPFGGKGIBLAOP-UHFFFAOYSA-N |
|---|
| SMILES | C=Cc1c(C(C)C)nc(C(C)C)c(C=O)c1-c1ccc(F)cc1OCc1ccccc1 |
|---|
