Introduction:Basic information about CAS 200815-49-2|Arformoterol tartrate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Arformoterol tartrate |
|---|
| CAS Number | 200815-49-2 | Molecular Weight | 494.492 |
|---|
| Density | / | Boiling Point | 603.2ºC at 760mmHg |
|---|
| Molecular Formula | C23H30N2O10 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (2R,3R)-2,3-dihydroxybutanedioic acid,N-[2-hydroxy-5-[(1R)-1-hydroxy-2-[[(2R)-1-(4-methoxyphenyl)propan-2-yl]amino]ethyl]phenyl]formamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 603.2ºC at 760mmHg |
|---|
| Molecular Formula | C23H30N2O10 |
|---|
| Molecular Weight | 494.492 |
|---|
| Exact Mass | 494.190033 |
|---|
| PSA | 205.88000 |
|---|
| LogP | 1.20050 |
|---|
| Vapour Pressure | 2.12E-15mmHg at 25°C |
|---|
| InChIKey | FCSXYHUNDAXDRH-OKMNHOJOSA-N |
|---|
| SMILES | COc1ccc(CC(C)NCC(O)c2ccc(O)c(NC=O)c2)cc1.O=C(O)C(O)C(O)C(=O)O |
|---|
| Storage condition | 2~8℃ |
|---|
Safety Information
Synonyms
| UNII-5P8VJ2I235 |
| (2R,3R)-2,3-Dihydroxybutandisäure--N-{2-hydroxy-5-[(1R)-1-hydroxy-2-{[(1R)-2-(4-methoxyphenyl)-1-methylethyl]amino}ethyl]phenyl}formamid(1:1) |
| (2R,3R)-2,3-Dihydroxysuccinic acid - N-{2-hydroxy-5-[(1R)-1-hydroxy-2-{[(2R)-1-(4-methoxyphenyl)-2-propanyl]amino}ethyl]phenyl}formamide (1:1) |
| Butanedioic acid, 2,3-dihydroxy-, (2R,3R)-, compd. with formamide, N-[2-hydroxy-5-[(1R)-1-hydroxy-2-[[(1R)-2-(4-methoxyphenyl)-1-methylethyl]amino]ethyl]phenyl]- (1:1) |
| Brovana (TN) |
| Brovana |
| (R,R)-Arformoterol tartrate |
| acide (2R,3R)-2,3-dihydroxybutanedioïque - N-{2-hydroxy-5-[(1R)-1-hydroxy-2-{[(1R)-2-(4-méthoxyphényl)-1-méthyléthyl]amino}éthyl]phényl}formamide (1:1) |
| UNII:5P8VJ2I235 |
| (R,R)-Formoterol tartrate |
| N-{2-hydroxy-5-[(1R)-1-hydroxy-2-{[(1R)-2-(4-methoxyphenyl)-1-methylethyl]amino}ethyl]phenyl}formamide 2,3-dihydroxybutanedioate (salt) |
| Arformoterol tartrate (USAN) |
| Brovana Inhalation Solution |
| Arformoterol tartrate |