Introduction：Basic information about CAS 118-86-5|Benzenesulfonic acid,2,2'-thiobis[5-amino-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzenesulfonic acid,2,2'-thiobis[5-amino- |
|---|
| CAS Number | 118-86-5 | Molecular Weight | 376.42800 |
|---|
| Density | 1.84g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C12H12N2O6S3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 5-amino-2-(4-amino-2-sulfophenyl)sulfanylbenzenesulfonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.84g/cm3 |
|---|
| Molecular Formula | C12H12N2O6S3 |
|---|
| Molecular Weight | 376.42800 |
|---|
| Exact Mass | 375.98600 |
|---|
| PSA | 202.84000 |
|---|
| LogP | 4.81960 |
|---|
| Index of Refraction | 1.802 |
|---|
| InChIKey | CHBFUBKXMBQCKO-UHFFFAOYSA-N |
|---|
| SMILES | Nc1ccc(Sc2ccc(N)cc2S(=O)(=O)O)c(S(=O)(=O)O)c1 |
|---|
Safety Information
Customs
| HS Code | 2930909090 |
|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 5,5'-Diamino-2,2'-sulfandiyl-bis-benzolsulfonsaeure |
| Thioanilinedisulfonic acid |
| EINECS 204-281-2 |
| 4.4'-Diamino-diphenylsulfid-disulfonsaeure-(2.2') |
| 6,6'-Thiodimetanilic acid |
| 5,5'-diamino-2,2'-sulfanediyl-bis-benzenesulfonic acid |
| 2,2'-thiobis(5-aminobenzenesulfonic) acid |
| Metanilic acid,6,6'-thiodi |
| 4,4'-diaminodiphenyl sulphide-2,2'-disulphonic acid |
| Metanilic acid,6'-thiodi |
| Benzenesulfonic acid,2,2'-thiobis[5-amino |
