Introduction:Basic information about CAS 35271-74-0|3-(4-Chlorophenyl)pentanedioic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(4-Chlorophenyl)pentanedioic acid |
|---|
| CAS Number | 35271-74-0 | Molecular Weight | 242.656 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 394.4±27.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H11ClO4 | Melting Point | 164-166°C |
|---|
| MSDS | / | Flash Point | 192.3±23.7 °C |
|---|
Names
| Name | 3-(4-chlorophenyl)pentanedioic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 394.4±27.0 °C at 760 mmHg |
|---|
| Melting Point | 164-166°C |
|---|
| Molecular Formula | C11H11ClO4 |
|---|
| Molecular Weight | 242.656 |
|---|
| Flash Point | 192.3±23.7 °C |
|---|
| Exact Mass | 242.034592 |
|---|
| PSA | 74.60000 |
|---|
| LogP | 1.16 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.579 |
|---|
| InChIKey | URXVLIVRJJNJII-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)CC(CC(=O)O)c1ccc(Cl)cc1 |
|---|
Safety Information
| Hazard Codes | T+ |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| HS Code | 2917399090 |
|---|
Customs
| HS Code | 2917399090 |
|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| MFCD00190249 |
| 3-(4-Chlorophenyl)pentanedioic acid |
| Pentanedioic acid, 3-(4-chlorophenyl)- |
| 3-(4-chlorophenyl)-pentanedioic acid |
| 3-(4-chloro-phenyl)-glutaric acid |
| EINECS 252-477-1 |
| QV1YR DG&1VQ |
| b-(4-Chlorophenyl) glutaric acid |
| 3-(4-chlorophenyl)pentane-1,5-dioic acid |