Introduction：Basic information about CAS 21021-53-4|2-(4-nitrophenyl)butanedioic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(4-nitrophenyl)butanedioic acid |
|---|
| CAS Number | 21021-53-4 | Molecular Weight | 239.18200 |
|---|
| Density | / | Boiling Point | 404.8ºC at 760 mmHg |
|---|
| Molecular Formula | C10H9NO6 | Melting Point | 216-218ºC |
|---|
| MSDS | / | Flash Point | 175.9ºC |
|---|
Names
| Name | 2-(4-nitrophenyl)butanedioic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 404.8ºC at 760 mmHg |
|---|
| Melting Point | 216-218ºC |
|---|
| Molecular Formula | C10H9NO6 |
|---|
| Molecular Weight | 239.18200 |
|---|
| Flash Point | 175.9ºC |
|---|
| Exact Mass | 239.04300 |
|---|
| PSA | 120.42000 |
|---|
| LogP | 1.76090 |
|---|
| Vapour Pressure | 2.79E-07mmHg at 25°C |
|---|
| InChIKey | HGBMGRXIQJGDDO-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)CC(C(=O)O)c1ccc([N+](=O)[O-])cc1 |
|---|
Safety Information
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| HS Code | 2917399090 |
|---|
Customs
| HS Code | 2917399090 |
|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| (4-Nitro-phenyl)-bernsteinsaeure |
| 2-(p-nitrophenyl)succinic acid |
| 4-Nitrophenylsuccinic acid |
| (4-nitrophenyl)ethane-1,2-dicarboxylic acid |
| 2-(4-Nitrophenyl)succinic acid |
| p-Nitrophenylsuccinic acid |
