Introduction:Basic information about CAS 80568-96-3|3-(3-methylphenyl)-1H-pyrazol-5-amine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(3-methylphenyl)-1H-pyrazol-5-amine |
|---|
| CAS Number | 80568-96-3 | Molecular Weight | 173.214 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 430.2±33.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H11N3 | Melting Point | 86-89ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 243.8±12.6 °C |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 5-(3-methylphenyl)-1H-pyrazol-3-amine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 430.2±33.0 °C at 760 mmHg |
|---|
| Melting Point | 86-89ºC |
|---|
| Molecular Formula | C10H11N3 |
|---|
| Molecular Weight | 173.214 |
|---|
| Flash Point | 243.8±12.6 °C |
|---|
| Exact Mass | 173.095291 |
|---|
| PSA | 54.70000 |
|---|
| LogP | 1.79 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.644 |
|---|
| InChIKey | KRRSPSCILJPKSA-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cccc(-c2cc(N)n[nH]2)c1 |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302 |
|---|
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
|---|
| Hazard Codes | Xi |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2933199090 |
|---|
Customs
| HS Code | 2933199090 |
|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 3-(3-methylphenyl)-1H-pyrazol-5-amine |
| 3-(3-methylphenyl)pyrazole-5-ylamine |
| 3-(m-Tolyl)-1H-pyrazole-5-carboxamide |
| 5-(3-Methylphenyl)-1H-pyrazol-3-amine |
| 5-m-Tolyl-2H-pyrazol-3-ylamine |
| 1H-Pyrazol-5-amine, 3-(3-methylphenyl)- |
| 1H-Pyrazol-3-amine, 5-(3-methylphenyl)- |
| 3-m-tolyl-1h-pyrazol-5-amine |
| 3-Amino-5-(3-methylphenyl)-1H-pyrazole |